GCD Summation: Exploring $\sum_{\gcd(i,n)=1} \gcd(i-1,n)$

by Artwalk Editor 58 views

Hey guys, today we're diving deep into a really cool problem in Number Theory that involves GCDs, LCMs, the Totient Function, and Arithmetic Functions. We're going to tackle this specific summation:

i=1,gcd(i,n)=1ngcd(i1,n)\sum_{i=1,\gcd(i,n)=1}^n \gcd(i-1,n)

Before we get into the nitty-gritty, let's set the stage. We're given an integer nn which can be broken down into its prime factors as n=p1a1p2a2p3a3n=p_1^{a_1}p_2^{a_2}p_3^{a_3}\ldots. Our mission, should we choose to accept it, is to show that this summation equals:

i(ai+1)(pi1)piai1\prod_{i} (a_i+1)(p_i-1)p_i^{a_i-1}

This looks a bit intimidating at first glance, right? But don't worry, we'll break it down step by step. It's all about understanding the properties of GCD and how they play with these arithmetic functions. We'll explore how the structure of nn influences the outcome of this sum. So, grab your thinking caps, and let's get this number theory party started!

Understanding the Core Components: GCD, Totient, and Arithmetic Functions

Alright, let's get our feet wet with the basics. First off, we have the Greatest Common Divisor (GCD). You guys know this one – it's the largest positive integer that divides two or more integers without leaving a remainder. When we see gcd(i,n)=1\gcd(i, n) = 1, it means that ii and nn are relatively prime, or coprime. They share no common factors other than 1. This condition is super important because it tells us which terms we're actually including in our summation. We're only interested in the values of ii between 1 and nn that don't share any prime factors with nn. This is where the Euler's Totient Function, often denoted as ϕ(n)\phi(n), comes into play. ϕ(n)\phi(n) counts the number of positive integers up to a given integer nn that are relatively prime to nn. So, the condition gcd(i,n)=1\gcd(i, n) = 1 directly relates to the count provided by ϕ(n)\phi(n). The number of terms in our summation is precisely ϕ(n)\phi(n)!

Now, let's talk about Arithmetic Functions. These are functions defined on the set of positive integers, usually related to number-theoretic properties. Our summation itself, i=1,gcd(i,n)=1ngcd(i1,n)\sum_{i=1,\gcd(i,n)=1}^n \gcd(i-1,n), is a form of an arithmetic function. We're defining a new function based on the properties of other numbers and their relationships. The term we're summing, gcd(i1,n)\gcd(i-1, n), means we're looking at the greatest common divisor between a number just before ii (that is coprime to nn) and nn itself. This is where things get interesting. We're not just summing up constants or ii itself; we're summing up the GCDs, which can vary depending on ii. The fact that we have the product form i(ai+1)(pi1)piai1\prod_{i} (a_i+1)(p_i-1)p_i^{a_i-1} on the right-hand side strongly suggests that the function we are evaluating is a multiplicative function. A function ff is multiplicative if for any two coprime positive integers mm and kk, we have f(mk)=f(m)f(k)f(mk) = f(m)f(k). This property is key to breaking down a problem involving nn into problems involving its prime power factors, piaip_i^{a_i}. If we can evaluate our summation for a prime power, say pap^a, and show that it follows the pattern of the formula, then by the multiplicative property, it will hold for any nn composed of such prime powers.

So, to recap, we've got GCDs defining our summation range and terms, the Totient function telling us how many terms we're dealing with, and the concept of Arithmetic Functions, particularly multiplicative ones, guiding us towards a solution involving prime factorization. It's a beautiful interplay of these fundamental number theory concepts. Understanding these building blocks is crucial before we start manipulating the summation itself. Let's keep these ideas in mind as we move forward to dissect the summation more rigorously.

Deconstructing the Summation: The Case of Prime Powers

Alright guys, now we're going to get our hands dirty and tackle the heart of the problem. The key strategy here, especially when we see that product form involving prime powers (piaip_i^{a_i}) in the target result, is to first analyze the summation when nn is a prime power. Let's consider n=pan = p^a, where pp is a prime number and a1a \ge 1. Our summation becomes:

i=1,gcd(i,pa)=1pagcd(i1,pa)\sum_{i=1,\gcd(i,p^a)=1}^{p^a} \gcd(i-1,p^a)

The condition gcd(i,pa)=1\gcd(i, p^a) = 1 means that ii is not divisible by pp. In other words, ii cannot be a multiple of pp. The numbers ii in the range 1ipa1 \le i \le p^a that are not divisible by pp are precisely those that are not p,2p,3p,,(pa1)pp, 2p, 3p, \ldots, (p^{a-1})p. There are pa1p^{a-1} such multiples. So, the total number of integers from 1 to pap^a is pap^a, and the number of integers divisible by pp is pa1p^{a-1}. Therefore, the count of integers ii such that gcd(i,pa)=1\gcd(i, p^a) = 1 is papa1=pa1(p1)p^a - p^{a-1} = p^{a-1}(p-1). This is exactly ϕ(pa)\phi(p^a), as expected!

Now, let's look at the term gcd(i1,pa)\gcd(i-1, p^a). Since ii is not divisible by pp, i1i-1 can be divisible by pp, or it might not be. However, if i1i-1 were divisible by pp, then i1=kpi-1 = kp for some integer kk. This would mean i=kp+1i = kp+1. If pp divides ii, then pp must divide kp+1kp+1. But if pp divides pp, it cannot divide kp+1kp+1 unless pp divides 1, which is impossible. This is a bit of a roundabout way to say that if gcd(i,pa)=1\gcd(i, p^a)=1, then pp does not divide ii. Consequently, pp cannot divide i1i-1 unless i1i-1 is a multiple of pp. However, let's consider the values of i1i-1 modulo pp. Since gcd(i,pa)=1\gcd(i, p^a)=1, i≢0(modp)i \not\equiv 0 \pmod{p}. Thus, i1≢1(modp)i-1 \not\equiv -1 \pmod{p}, which means i1≢p1(modp)i-1 \not\equiv p-1 \pmod{p}. This doesn't directly simplify gcd(i1,pa)\gcd(i-1, p^a) yet.

Let's consider the possible values for gcd(i1,pa)\gcd(i-1, p^a). The divisors of pap^a are 1,p,p2,,pa1, p, p^2, \ldots, p^a. So, gcd(i1,pa)\gcd(i-1, p^a) must be one of these values. If gcd(i1,pa)=pk\gcd(i-1, p^a) = p^k for k1k \ge 1, it means pkp^k divides i1i-1. This implies pp divides i1i-1. If pp divides i1i-1, then i1=mpi-1 = mp for some integer mm. This means i=mp+1i = mp+1. If pp divides ii, then gcd(i,pa)\gcd(i, p^a) would be at least pp, contradicting gcd(i,pa)=1\gcd(i, p^a)=1. Therefore, if gcd(i,pa)=1\gcd(i, p^a)=1, it must be that pp does not divide i1i-1. Why? Because if pp divides i1i-1, then i1i-1 is a multiple of pp. If i1i-1 is a multiple of pp, then iextleavesaremainderof1extwhendividedbypi ext{ leaves a remainder of } 1 ext{ when divided by } p, i.e., i1(modp)i \equiv 1 \pmod{p}. If iot0ext(modp)i ot\equiv 0 ext{ (mod } p), then gcd(i,pa)\gcd(i, p^a) can be greater than 1 only if ii shares some prime factors with pap^a. Since pp is the only prime factor of pap^a, gcd(i,pa)>1\gcd(i, p^a) > 1 if and only if pp divides ii. So, the condition gcd(i,pa)=1\gcd(i, p^a)=1 implies pmidip mid i. Now, if pmid(i1)p mid (i-1), then the only common divisor between i1i-1 and pap^a is 1. This means gcd(i1,pa)=1\gcd(i-1, p^a) = 1 for all ii such that gcd(i,pa)=1\gcd(i, p^a)=1. Wait, this seems too simple. Let's re-evaluate.

My bad, guys! I jumped to a conclusion too fast. Let's rethink gcd(i1,pa)\gcd(i-1, p^a). We know gcd(i,pa)=1\gcd(i, p^a)=1. This means pmidip mid i. Now consider i1i-1. Can pp divide i1i-1? Yes, it can! For example, if n=p2n=p^2 and i=p+1i=p+1. Then gcd(i,p2)=gcd(p+1,p2)=1\gcd(i, p^2) = \gcd(p+1, p^2) = 1 (since pp doesn't divide p+1p+1). But i1=pi-1 = p. So gcd(i1,p2)=gcd(p,p2)=p\gcd(i-1, p^2) = \gcd(p, p^2) = p. So gcd(i1,pa)\gcd(i-1, p^a) is not always 1.

Let d=gcd(i1,pa)d = \gcd(i-1, p^a). Then dd must be of the form pkp^k for some 0ka0 \le k \le a. If d=pkd = p^k with k1k \ge 1, then pk(i1)p^k | (i-1). This implies p(i1)p | (i-1). If p(i1)p | (i-1), then i1=mpi-1 = mp for some integer mm. This means i=mp+1i = mp+1. If pp divides ii, then gcd(i,pa)e1\gcd(i, p^a) e 1. This is a contradiction to our summation condition gcd(i,pa)=1\gcd(i, p^a)=1. Ah, here's the crucial insight: if gcd(i,pa)=1\gcd(i, p^a)=1, then pmidip mid i. If pmidip mid i, then ii is not a multiple of pp. Consider i1i-1. If pmid(i1)p mid (i-1), then gcd(i1,pa)=1\gcd(i-1, p^a)=1. If p(i1)p | (i-1), then i1=mpi-1 = mp. This implies i=mp+1i = mp+1. If mm is a multiple of pp, say m=qpm=qp, then i=qp2+1i = qp^2+1. In general, if i=mp+1i = mp+1, does this imply pip|i? Yes, if pmpp|mp. This is always true. So, if p(i1)p | (i-1), then i=mp+1i = mp+1. This means i1(modp)i \equiv 1 \pmod p. If pmidip mid i, then gcd(i,pa)=1\gcd(i, p^a)=1. So, i1i-1 can be a multiple of pp.

Let's try another angle. Let S=i=1,gcd(i,pa)=1pagcd(i1,pa)S = \sum_{i=1,\gcd(i,p^a)=1}^{p^a} \gcd(i-1,p^a). Consider the pairs (i,i1)(i, i-1) where gcd(i,pa)=1\gcd(i, p^a)=1. As ii ranges over the ϕ(pa)\phi(p^a) values, i1i-1 takes values modulo pap^a. Let j=i1j = i-1. As ii ranges from 11 to pap^a with gcd(i,pa)=1\gcd(i, p^a)=1, then ii takes values 1,2,,p1,p+1,,2p1,2p+1,,pa1, 2, \ldots, p-1, p+1, \ldots, 2p-1, 2p+1, \ldots, p^a. The corresponding values of j=i1j=i-1 are 0,1,,p2,p,,2p1,2p,,pa10, 1, \ldots, p-2, p, \ldots, 2p-1, 2p, \ldots, p^a-1. The condition gcd(i,pa)=1\gcd(i, p^a)=1 means pmidip mid i. If pmidip mid i, then i≢0ext(modp)i \not\equiv 0 ext{ (mod } p). So i1ot1ext(modp)i-1 ot\equiv -1 ext{ (mod } p), which is i1otp1ext(modp)i-1 ot\equiv p-1 ext{ (mod } p).

Now, let's analyze gcd(i1,pa)\gcd(i-1, p^a). If i=1i=1, gcd(1,pa)=1\gcd(1, p^a)=1. Then gcd(i1,pa)=gcd(0,pa)=pa\gcd(i-1, p^a) = \gcd(0, p^a) = p^a. This term is included. If i=p+1i=p+1, gcd(p+1,pa)=1\gcd(p+1, p^a)=1. Then gcd(i1,pa)=gcd(p,pa)=p\gcd(i-1, p^a) = \gcd(p, p^a) = p. This term is included. If i=pk+1i=p^k+1 for 1ek<a1 e k < a, gcd(pk+1,pa)=1\gcd(p^k+1, p^a)=1. Then gcd(i1,pa)=gcd(pk,pa)=pk\gcd(i-1, p^a) = \gcd(p^k, p^a) = p^k. This term is included. If i=pa+1i=p^a+1, this is i=1ext(modpa)i=1 ext{ (mod } p^a), so it's not in the range.

Let's look at the values of ii such that gcd(i,pa)=1\gcd(i, p^a)=1. These are numbers not divisible by pp. Consider the sum S=i=1,gcd(i,pa)=1pagcd(i1,pa)S = \sum_{i=1,\gcd(i,p^a)=1}^{p^a} \gcd(i-1,p^a). Let g=gcd(i1,pa)g = \gcd(i-1, p^a). Then gg must be a power of pp, say pkp^k where 0ka0 \\\le k \\\le a. If pk(i1)p^k | (i-1), then i1=mpki-1 = m p^k. This means i=mpk+1i = m p^k + 1. We are given gcd(i,pa)=1\gcd(i, p^a)=1, which means pmidip mid i. So, pmid(mpk+1)p mid (m p^k + 1). This is always true if pmid1p mid 1, which is true. Wait, this doesn't help eliminate cases.

The condition gcd(i,pa)=1\gcd(i, p^a)=1 means pmidip mid i. So ii cannot be p,2p,3p,,pa1pp, 2p, 3p, \ldots, p^{a-1}p.

Let's consider the values of i1i-1 when gcd(i,pa)=1\gcd(i, p^a)=1. If i=1i=1, gcd(1,pa)=1\gcd(1,p^a)=1. gcd(i1,pa)=gcd(0,pa)=pa\gcd(i-1,p^a) = \gcd(0,p^a) = p^a. Term: pap^a. If i=p+1i=p+1, gcd(p+1,pa)=1\gcd(p+1,p^a)=1. gcd(i1,pa)=gcd(p,pa)=p\gcd(i-1,p^a) = \gcd(p,p^a) = p. Term: pp. If i=p2+1i=p^2+1, gcd(p2+1,pa)=1\gcd(p^2+1,p^a)=1. gcd(i1,pa)=gcd(p2,pa)=p2\gcd(i-1,p^a) = \gcd(p^2,p^a) = p^2 (assuming a2a \\\ge 2). Term: p2p^2. In general, if i=pk+1i=p^k+1 for 1ka1 \\\le k \\\le a, and if gcd(pk+1,pa)=1\gcd(p^k+1, p^a)=1, then gcd(i1,pa)=gcd(pk,pa)=pk\gcd(i-1, p^a) = \gcd(p^k, p^a) = p^k. When is gcd(pk+1,pa)=1\gcd(p^k+1, p^a)=1? This is true if pmid(pk+1)p mid (p^k+1). If k1k \\\ge 1, then ppkp | p^k, so pmid(pk+1)p mid (p^k+1). Thus, for all kk from 1 to aa, if i=pk+1i = p^k+1, we have gcd(i,pa)=1\gcd(i, p^a)=1, and gcd(i1,pa)=pk\gcd(i-1, p^a) = p^k.

How many such terms are there? The values of ii are pk+1p^k+1. For k=1,,ak=1, \ldots, a, these are p+1,p2+1,,pa+1p+1, p^2+1, \ldots, p^a+1. Note that pa+11ext(modpa)p^a+1 \equiv 1 ext{ (mod } p^a). So pa+1p^a+1 is congruent to 1 modulo pap^a.

Let's be careful. The values of ii are in the range 1ipa1 \\\le i \\\le p^a. So, i=1i=1 gives gcd(i1,pa)=pa\gcd(i-1, p^a) = p^a. i=p+1i=p+1 gives gcd(i1,pa)=p\gcd(i-1, p^a) = p. i=p2+1i=p^2+1 gives gcd(i1,pa)=p2\gcd(i-1, p^a) = p^2 (if a2a \\\ge 2). ... i=pa1+1i=p^{a-1}+1 gives gcd(i1,pa)=pa1\gcd(i-1, p^a) = p^{a-1} (if a1a \\\ge 1). What about i=pa+1i=p^a+1? This is outside the range 1i\ullepa1 \\\le i \ulle p^a. But pa+1extiscongruentto1ext(modpa)p^a+1 ext{ is congruent to } 1 ext{ (mod } p^a). So i=pa+1i=p^a+1 behaves like i=1i=1 in terms of value modulo pap^a.

Let's analyze the terms gcd(i1,pa)\gcd(i-1, p^a). These are powers of pp, pkp^k. How many times does pkp^k appear as gcd(i1,pa)\gcd(i-1, p^a) for gcd(i,pa)=1\gcd(i, p^a)=1? Let d=gcd(i1,pa)=pkd = \gcd(i-1, p^a) = p^k. This means pk(i1)p^k | (i-1) and pk+1mid(i1)p^{k+1} mid (i-1). Also, gcd(i,pa)=1\gcd(i, p^a)=1, which means pmidip mid i. If pk(i1)p^k | (i-1), then i1=mpki-1 = m p^k. So i=mpk+1i = m p^k + 1. If pmidip mid i, then pmid(mpk+1)p mid (m p^k + 1). This is always true since pmid1p mid 1. So, we need to count the number of iextin[1,pa]i ext{ in } [1, p^a] such that gcd(i,pa)=1\gcd(i, p^a)=1 and gcd(i1,pa)=pk\gcd(i-1, p^a)=p^k.

This means pk(i1)p^k | (i-1) and pmidip mid i. i1i-1 must be a multiple of pkp^k. So i1=cpki-1 = c p^k for some integer cc. Thus i=cpk+1i = c p^k + 1. We require pmidip mid i, so pmid(cpk+1)p mid (c p^k + 1). This is true for any cc as long as pmid1p mid 1. We also require gcd(i1,pa)=pk\gcd(i-1, p^a) = p^k. This means pk(i1)p^k | (i-1) but pk+1mid(i1)p^{k+1} mid (i-1). So, i1i-1 is a multiple of pkp^k but not pk+1p^{k+1}. i1=cpki-1 = c p^k where pmidcp mid c. Also, iextmustbein[1,pa]i ext{ must be in } [1, p^a]. So 1cpk+1\ullepa1 \\\le c p^k + 1 \ulle p^a. This means 0cpk\ullepa10 \\\le c p^k \ulle p^a - 1. So 0\ullec\ulle(pa1)/pk0 \ulle c \ulle \lfloor (p^a-1)/p^k \rfloor. And we need pmidcp mid c.

Let's consider the values of kk from 00 to aa.

Case k=ak=a: gcd(i1,pa)=pa\gcd(i-1, p^a) = p^a. This means pa(i1)p^a | (i-1). Since 1i\ullepa1 \\\le i \ulle p^a, the only possibility is i1=0i-1=0, so i=1i=1. Check gcd(i,pa)=gcd(1,pa)=1\gcd(i, p^a)=\gcd(1, p^a)=1. Yes. So i=1i=1 contributes pap^a to the sum. There is 1 such term.

Case k=a1k=a-1: gcd(i1,pa)=pa1\gcd(i-1, p^a) = p^{a-1}. This means pa1(i1)p^{a-1} | (i-1) and pamid(i1)p^a mid (i-1). So i1=cpa1i-1 = c p^{a-1} where pmidcp mid c. Also gcd(i,pa)=1\gcd(i, p^a)=1, which means pmidip mid i. i=cpa1+1i = c p^{a-1} + 1. Since pmidcp mid c, pmid(cpa1+1)p mid (c p^{a-1} + 1) is always true for a11a-1 \\\ge 1. If a1=0a-1=0 (i.e., a=1a=1), then i=c+1i = c+1. And pmidip mid i. If a=1a=1, n=pn=p. We need gcd(i,p)=1\gcd(i, p)=1, so pmidip mid i. i=1,,p1i=1, \ldots, p-1. Sum is i=1p1gcd(i1,p)\sum_{i=1}^{p-1} \gcd(i-1, p). If i=1i=1, gcd(0,p)=p\gcd(0, p)=p. If i=2,,p1i=2, \ldots, p-1, then i1=1,,p2i-1 = 1, \ldots, p-2. gcd(i1,p)=1\gcd(i-1, p)=1 because i1i-1 is not a multiple of pp. So for n=pn=p, sum is p+i=2p11=p+(p2)=2p2p + \sum_{i=2}^{p-1} 1 = p + (p-2) = 2p-2. Formula gives (a+1)(p1)pa1=(1+1)(p1)p11=2(p1)p0=2(p1)=2p2(a+1)(p-1)p^{a-1} = (1+1)(p-1)p^{1-1} = 2(p-1)p^0 = 2(p-1) = 2p-2. It matches for a=1a=1.

Let's go back to n=pan=p^a. We need i=cpa1+1i = c p^{a-1} + 1, with pmidcp mid c, and 1i\ullepa1 \\\le i \ulle p^a. 1\ullecpa1+1\ullepa1 \ulle c p^{a-1} + 1 \ulle p^a. 0\ullecpa1\ullepa10 \ulle c p^{a-1} \ulle p^a - 1. 0\ullec\ulle(pa1)/pa1=p1/pa1=p10 \ulle c \ulle \lfloor (p^a-1)/p^{a-1} \rfloor = \lfloor p - 1/p^{a-1} \rfloor = p-1. So cc can be 0,1,,p10, 1, \ldots, p-1. We need pmidcp mid c. So cc can be 1,2,,p11, 2, \ldots, p-1. There are p1p-1 such values of cc. So there are p1p-1 values of ii for which gcd(i1,pa)=pa1\gcd(i-1, p^a) = p^{a-1}. These values are i=cpa1+1i = c p^{a-1} + 1 for c=1,,p1c=1, \ldots, p-1. Contribution: (p1)×pa1(p-1) \times p^{a-1}.

Case kk: gcd(i1,pa)=pk\gcd(i-1, p^a) = p^k. This means pk(i1)p^k | (i-1) and pk+1mid(i1)p^{k+1} mid (i-1). So i1=cpki-1 = c p^k where pmidcp mid c. Also gcd(i,pa)=1\gcd(i, p^a)=1, so pmidip mid i. i=cpk+1i = c p^k + 1. If k1k \\\ge 1, then pmid(cpk+1)p mid (c p^k + 1) is always true. We need 1\ullecpk+1\ullepa1 \ulle c p^k + 1 \ulle p^a. 0\ullecpk\ullepa10 \ulle c p^k \ulle p^a - 1. 0\ullec\ulle(pa1)/pk0 \ulle c \ulle \lfloor (p^a-1)/p^k \rfloor. cc takes values from 00 up to pak1/pk=pak1\lfloor p^{a-k} - 1/p^k \rfloor = p^{a-k}-1. So cc can be 0,1,,pak10, 1, \ldots, p^{a-k}-1. Total pakp^{a-k} values. We need pmidcp mid c. The values of cc that are multiples of pp are p,2p,,(pak11)pp, 2p, \ldots, (p^{a-k-1}-1)p. There are pak1p^{a-k-1} such multiples. So the number of values of cc such that pmidcp mid c is pakpak1p^{a-k} - p^{a-k-1}. These are the number of ii values for which gcd(i1,pa)=pk\gcd(i-1, p^a) = p^k. Contribution for a given kk: (pakpak1)×pk=papa1(p^{a-k} - p^{a-k-1}) \times p^k = p^a - p^{a-1}. This is for k1k \\\ge 1.

Let's recheck k=a1k=a-1. Number of terms: pa(a1)pa(a1)1=p1p0=p1p^{a-(a-1)} - p^{a-(a-1)-1} = p^1 - p^0 = p-1. Contribution: (p1)pa1(p-1)p^{a-1}. Correct.

Let's recheck k=ak=a. We found 1 term, contributing pap^a. The formula gives paapaa1p^{a-a} - p^{a-a-1}? This formula is for k1k \\\ge 1. So we need to handle k=0k=0 and k=ak=a separately.

Let's refine the count of ii for gcd(i1,pa)=pk\gcd(i-1, p^a) = p^k. i1=cpki-1 = c p^k where pmidcp mid c. i=cpk+1i = c p^k + 1. Condition gcd(i,pa)=1\gcd(i, p^a)=1 means pmidip mid i. If k1k \\\ge 1, pmidcpkp mid c p^k, so pmid(cpk+1)p mid (c p^k+1). Always satisfied. If k=0k=0, i1=ci-1 = c. i=c+1i = c+1. We need pmidip mid i. So pmid(c+1)p mid (c+1). Also gcd(i1,pa)=gcd(c,pa)=p0=1\gcd(i-1, p^a) = \gcd(c, p^a) = p^0 = 1. So pmidcp mid c. So for k=0k=0, we need pmidcp mid c and pmid(c+1)p mid (c+1). And 1\ullec+1\ullepa1 \ulle c+1 \ulle p^a. This implies 0\ullec\ullepa10 \ulle c \ulle p^a-1. Number of cc in [0,pa1][0, p^a-1] such that pmidcp mid c and pmid(c+1)p mid (c+1). Total numbers in [0,pa1][0, p^a-1] is pap^a. Number of multiples of pp is pa1p^{a-1}. Number of cc such that pmidcp mid c is papa1p^a - p^{a-1}. Among these, we need pmid(c+1)p mid (c+1). If pmidcp mid c, then cot0ext(modp)c ot\equiv 0 ext{ (mod } p). So c+1ot1ext(modp)c+1 ot\equiv 1 ext{ (mod } p). Wait, this is not useful. If pmidcp mid c, then cc can be 1,2,,p11, 2, \ldots, p-1 mod pp. If c1ext(modp)c \\\equiv 1 ext{ (mod } p), then c+12ext(modp)c+1 \\\equiv 2 ext{ (mod } p). If cotp1ext(modp)c ot\equiv p-1 ext{ (mod } p), then c+1ot0ext(modp)c+1 ot\equiv 0 ext{ (mod } p). So we need to exclude values of cc such that pcp|c OR p(c+1)p|(c+1). cc is a multiple of pp: 0,p,2p,,(pa11)p0, p, 2p, \ldots, (p^{a-1}-1)p. There are pa1p^{a-1} such values. c+1c+1 is a multiple of pp: c+1=mpc+1 = mp. c=mp1c = mp-1. c1p1ext(modp)c \equiv -1 \equiv p-1 ext{ (mod } p). Values of cc in [0,pa1][0, p^a-1] such that cp1ext(modp)c \\\equiv p-1 ext{ (mod } p): p1,2p1,,(pa1)p1p-1, 2p-1, \ldots, (p^{a-1})p - 1. There are pa1p^{a-1} such values. Total values to exclude: pa1+pa1=2pa1p^{a-1} + p^{a-1} = 2p^{a-1}. Total values of cc in [0,pa1][0, p^a-1] is pap^a. Number of cc such that pmidcp mid c and pmid(c+1)p mid (c+1) is pa2pa1p^a - 2p^{a-1}. This is for k=0k=0. Contribution: (pa2pa1)imes1=pa2pa1(p^a - 2p^{a-1}) imes 1 = p^a - 2p^{a-1}. This seems wrong.

Let's retry the sum for n=pan=p^a.

S=i=1,gcd(i,pa)=1pagcd(i1,pa)S = \sum_{i=1,\gcd(i,p^a)=1}^{p^a} \gcd(i-1,p^a)

Let j=i1j=i-1. As ii goes through values coprime to pap^a, jj goes through values 0,1,,pa10, 1, \ldots, p^a-1 such that j+1j+1 is coprime to pap^a. j+1ot0ext(modp)j+1 ot\equiv 0 ext{ (mod } p). So jot1ext(modp)j ot\equiv -1 ext{ (mod } p), i.e., jotp1ext(modp)j ot\equiv p-1 ext{ (mod } p).

So the sum is S=j=0,  j≢p1 (mod p)pa1gcd(j,pa)S = \sum_{j=0,\; j \not\equiv p-1 \text{ (mod } p)}^{p^a-1} \gcd(j, p^a).

The terms are gcd(j,pa)\gcd(j, p^a). This can be pkp^k for 0k\ullea0 \\\le k \ulle a. We need to sum pkp^k for all jj in the range [0,pa1][0, p^a-1] such that jotp1ext(modp)j ot\equiv p-1 ext{ (mod } p), weighted by how many times gcd(j,pa)=pk\gcd(j, p^a)=p^k.

Let's sum over the possible values of gcd(j,pa)=pk\gcd(j, p^a) = p^k. pkjp^k | j and pk+1midjp^{k+1} mid j. So j=mpkj = m p^k where pmidmp mid m. We need 0\ullej\ullepa10 \ulle j \ulle p^a-1. So 0\ullempk\ullepa10 \ulle m p^k \ulle p^a-1. 0\ullem\ulle(pa1)/pk=pak10 \ulle m \ulle \lfloor (p^a-1)/p^k \rfloor = p^{a-k}-1. So mm can be 0,1,,pak10, 1, \ldots, p^{a-k}-1. We need pmidmp mid m. Number of values for mm: pakpak1p^{a-k} - p^{a-k-1} (for k<ak < a). If k=ak=a, then j=mpaj=m p^a. 0\ullempa\ullepa10 \ulle m p^a \ulle p^a-1. Only m=0m=0, so j=0j=0. gcd(0,pa)=pa\gcd(0, p^a)=p^a.

Let's count for each kk how many jj satisfy gcd(j,pa)=pk\gcd(j, p^a)=p^k and jotp1ext(modp)j ot\equiv p-1 ext{ (mod } p).

For k=ak=a: j=0j=0. Is 0otp1ext(modp)0 ot\equiv p-1 ext{ (mod } p)? Yes, 0otp1ext(modp)0 ot\equiv p-1 ext{ (mod } p) since pe1p e 1. So j=0j=0 is included. gcd(0,pa)=pa\gcd(0, p^a)=p^a. Contribution: pap^a. (1 term)

For k[0,a1]k \\\in [0, a-1]: Number of jj such that gcd(j,pa)=pk\gcd(j, p^a)=p^k is pakpak1p^{a-k}-p^{a-k-1}. These jj are of the form mpkm p^k where pmidmp mid m and 0\ullem\ullepak10 \ulle m \ulle p^{a-k}-1. We need to check the condition jotp1ext(modp)j ot\equiv p-1 ext{ (mod } p). mpkotp1ext(modp)m p^k ot\equiv p-1 ext{ (mod } p). If k1k \\\ge 1, then mpk0ext(modp)m p^k \\\equiv 0 ext{ (mod } p). So the condition is 0otp1ext(modp)0 ot\equiv p-1 ext{ (mod } p), which is true. So for k[1,a1]k \\\in [1, a-1], all pakpak1p^{a-k}-p^{a-k-1} terms satisfy the condition. Contribution for k[1,a1]k \\\in [1, a-1]: (pakpak1)imespk=papa1(p^{a-k}-p^{a-k-1}) imes p^k = p^a - p^{a-1}. Total sum for k=1k=1 to a1a-1: k=1a1(papa1)=(a1)(papa1)\sum_{k=1}^{a-1} (p^a - p^{a-1}) = (a-1)(p^a - p^{a-1}).

Now consider k=0k=0. Number of jj such that gcd(j,pa)=1\gcd(j, p^a)=1 is papa1p^a-p^{a-1}. These jj are of the form mm where pmidmp mid m and 0\ullem\ullepa10 \ulle m \ulle p^a-1. We need to check jotp1ext(modp)j ot\equiv p-1 ext{ (mod } p). So motp1ext(modp)m ot\equiv p-1 ext{ (mod } p). Number of mm in [0,pa1][0, p^a-1] such that pmidmp mid m is papa1p^a-p^{a-1}. Among these, how many are p1ext(modp)\\\equiv p-1 ext{ (mod } p)? If mot0ext(modp)m ot\equiv 0 ext{ (mod } p) and motp1ext(modp)m ot\equiv p-1 ext{ (mod } p), then these are the terms we want. Values of mm in [0,pa1][0, p^a-1] are pap^a. Multiples of pp: pa1p^{a-1}. Values p1ext(modp)\\\equiv p-1 ext{ (mod } p): pa1p^{a-1}. So numbers that are NOT multiples of pp AND NOT \ igurative p-1 ext (mod } p)$ is papa1pa1=pa2pa1p^a - p^{a-1} - p^{a-1} = p^a - 2p^{a-1}. This is the number of terms with gcd(j,pa)=1\gcd(j, p^a)=1 that satisfy jotp1ext(modp)j ot\equiv p-1 ext{ (mod } p). Contribution for k=0k=0 $(p^a - 2p^{a-1) imes 1 = p^a - 2p^{a-1}$.

Total sum S=paext(fork=a)+(pa2pa1)ext(fork=0)+k=1a1(papa1)S = p^a ext{ (for } k=a) + (p^a - 2p^{a-1}) ext{ (for } k=0) + \sum_{k=1}^{a-1} (p^a - p^{a-1}). S=pa+pa2pa1+(a1)(papa1)S = p^a + p^a - 2p^{a-1} + (a-1)(p^a - p^{a-1}). S=2pa2pa1+(a1)pa(a1)pa1S = 2p^a - 2p^{a-1} + (a-1)p^a - (a-1)p^{a-1}. S=(2+a1)pa(2+a1)pa1S = (2 + a - 1)p^a - (2 + a - 1)p^{a-1}. S=(a+1)pa(a+1)pa1S = (a+1)p^a - (a+1)p^{a-1}. S=(a+1)(papa1)S = (a+1)(p^a - p^{a-1}). S=(a+1)pa1(p1)S = (a+1)p^{a-1}(p-1).

This matches the formula for n=pan=p^a: (ai+1)(pi1)piai1(a_i+1)(p_i-1)p_i^{a_i-1} becomes (a+1)(p1)pa1(a+1)(p-1)p^{a-1}. Phew!

So, for a prime power n=pan=p^a, the sum is indeed (a+1)(p1)pa1(a+1)(p-1)p^{a-1}. This is a massive step!

Proving Multiplicativity and Finalizing the Proof

Okay guys, we've conquered the beast for prime powers! We showed that if n=pan=p^a, then i=1,gcd(i,n)=1ngcd(i1,n)=(a+1)(p1)pa1\sum_{i=1,\gcd(i,n)=1}^n \gcd(i-1,n) = (a+1)(p-1)p^{a-1}. Remember our target formula is i(ai+1)(pi1)piai1\prod_{i} (a_i+1)(p_i-1)p_i^{a_i-1}.

Now, the magic of multiplicative functions comes into play. Let F(n)=i=1,gcd(i,n)=1ngcd(i1,n)F(n) = \sum_{i=1,\gcd(i,n)=1}^n \gcd(i-1,n). We need to show that F(n)F(n) is a multiplicative function. A function FF is multiplicative if for any two coprime positive integers mm and kk (i.e., gcd(m,k)=1\gcd(m,k)=1), we have F(mk)=F(m)F(k)F(mk) = F(m)F(k).

Suppose n=mkn = mk where gcd(m,k)=1\gcd(m,k)=1. We want to show F(mk)=F(m)F(k)F(mk) = F(m)F(k).

F(mk)=i=1,gcd(i,mk)=1mkgcd(i1,mk)F(mk) = \sum_{i=1,\gcd(i,mk)=1}^{mk} \gcd(i-1,mk)

The condition gcd(i,mk)=1\gcd(i,mk)=1 means that gcd(i,m)=1\gcd(i,m)=1 AND gcd(i,k)=1\gcd(i,k)=1.

This is where the Chinese Remainder Theorem (CRT) is super handy. For any integer ii such that 1\ullei\ullemk1 \ulle i \ulle mk, the pair of congruences iext(modm)i ext{ (mod } m) and iext(modk)i ext{ (mod } k) uniquely determines iext(modmk)i ext{ (mod } mk).

Let d=gcd(i1,mk)d = \gcd(i-1, mk). If gcd(i,m)=1\gcd(i,m)=1 and gcd(i,k)=1\gcd(i,k)=1, then dd must divide mkmk.

Consider the properties of gcd\gcd with coprime numbers. If gcd(a,b)=1\gcd(a,b)=1, then gcd(a,c)\gcd(a,c) and gcd(b,c)\gcd(b,c) are related to gcd(ab,c)\gcd(ab, c). Specifically, gcd(ab,c)=gcd(a,c)gcd(b,c)\gcd(ab, c) = \gcd(a,c) \gcd(b,c) if gcd(a,b)=1\gcd(a,b)=1.

Let dm=gcd(i1,m)d_m = \gcd(i-1, m) and dk=gcd(i1,k)d_k = \gcd(i-1, k). Since gcd(m,k)=1\gcd(m,k)=1, it follows that gcd(dm,dk)=gcd(gcd(i1,m),gcd(i1,k))=gcd(i1,gcd(m,k))=gcd(i1,1)=1\gcd(d_m, d_k) = \gcd(\gcd(i-1, m), \gcd(i-1, k)) = \gcd(i-1, \gcd(m,k)) = \gcd(i-1, 1) = 1.

Also, gcd(i1,mk)=gcd(i1,m)gcd(i1,k)=dmdk\gcd(i-1, mk) = \gcd(i-1, m) \gcd(i-1, k) = d_m d_k. This property holds when gcd(m,k)=1\gcd(m,k)=1!

So, F(mk)=i=1,gcd(i,m)=1,gcd(i,k)=1mkgcd(i1,m)gcd(i1,k)F(mk) = \sum_{i=1,\atop\gcd(i,m)=1,\gcd(i,k)=1}^{mk} \gcd(i-1,m) \gcd(i-1,k).

Now, let's think about the set of ii in [1,mk][1, mk] such that gcd(i,m)=1\gcd(i,m)=1 and gcd(i,k)=1\gcd(i,k)=1. By CRT, there's a one-to-one correspondence between these ii's and pairs (im,ik)(i_m, i_k) where 1ext(modm)1 ext{ (mod } m) and 1ext(modk)1 ext{ (mod } k). Wait, not quite. It's pairs (im,ik)(i_m, i_k) where imextrunsthrough[1,m]extwithgcd(im,m)=1i_m ext{ runs through } [1,m] ext{ with } \gcd(i_m, m)=1 and ikextrunsthrough[1,k]extwithgcd(ik,k)=1i_k ext{ runs through } [1,k] ext{ with } \gcd(i_k, k)=1.

Let ii be such that gcd(i,mk)=1\gcd(i,mk)=1. Then ii can be uniquely represented by (im,ik)(i_m, i_k) where i\ igurativeimext(modm)i \ igurative i_m ext{ (mod } m) and i\ igurativeikext(modk)i \ igurative i_k ext{ (mod } k). The condition gcd(i,mk)=1\gcd(i,mk)=1 means gcd(i,m)=1\gcd(i,m)=1 and gcd(i,k)=1\gcd(i,k)=1. This implies gcd(im,m)=1\gcd(i_m, m)=1 and gcd(ik,k)=1\gcd(i_k, k)=1.

Also, i1ext(modm)=im1ext(modm)i-1 ext{ (mod } m) = i_m - 1 ext{ (mod } m) and i1ext(modk)=ik1ext(modk)i-1 ext{ (mod } k) = i_k - 1 ext{ (mod } k).

And gcd(i1,mk)=gcd(i1,m)gcd(i1,k)\gcd(i-1, mk) = \gcd(i-1, m) \gcd(i-1, k).

Let's rewrite the sum using this decomposition. The set of ii such that gcd(i,mk)=1\gcd(i,mk)=1 is formed by taking ii such that iext(modm)i ext{ (mod } m) is coprime to mm and iext(modk)i ext{ (mod } k) is coprime to kk.

By CRT, for each pair (u,v)(u,v) where gcd(u,m)=1\gcd(u,m)=1 and gcd(v,k)=1\gcd(v,k)=1, there is a unique iext(modmk)i ext{ (mod } mk) such that iext(modm)=ui ext{ (mod } m) = u and iext(modk)=vi ext{ (mod } k) = v.

So, $F(mk) =

\sum_{\substack{u=1 \ \gcd(u,m)=1}}^m

\sum_{\substack{v=1 \ \gcd(v,k)=1}}^k

\gcd(i-1,m) \gcd(i-1,k)

where iextisthesolutiontoi\ igurativeuext(modm),i\ igurativevext(modk)i ext{ is the solution to } i \ igurative u ext{ (mod } m), i \ igurative v ext{ (mod } k).

Let im=ui_m = u and ik=vi_k = v. Then i1ext(modm)=u1ext(modm)i-1 ext{ (mod } m) = u-1 ext{ (mod } m) and i1ext(modk)=v1ext(modk)i-1 ext{ (mod } k) = v-1 ext{ (mod } k).

So gcd(i1,m)=gcd(u1,m)\gcd(i-1, m) = \gcd(u-1, m) and gcd(i1,k)=gcd(v1,k)\gcd(i-1, k) = \gcd(v-1, k).

Thus, $F(mk) =

\sum_{\substack{u=1 \ \gcd(u,m)=1}}^m

\sum_{\substack{v=1 \ \gcd(v,k)=1}}^k

\gcd(u-1,m) \gcd(v-1,k)

This sum can be separated:

$F(mk) =

\left( \sum_{\substack{u=1 \ \gcd(u,m)=1}}^m \gcd(u-1,m)

\right)

\left( \sum_{\substack{v=1 \ \gcd(v,k)=1}}^k \gcd(v-1,k)

\right)$

The first parenthesis is exactly F(m)F(m), and the second is F(k)F(k).

So, F(mk)=F(m)F(k)F(mk) = F(m)F(k) when gcd(m,k)=1\gcd(m,k)=1. This proves that F(n)F(n) is a multiplicative function.

Now, we know that if n=p1a1p2a2prarn=p_1^{a_1}p_2^{a_2}\ldots p_r^{a_r} is the prime factorization of nn, since piaip_i^{a_i} are pairwise coprime, we have:

F(n)=F(p1a1)F(p2a2)F(prar)F(n) = F(p_1^{a_1}) F(p_2^{a_2}) \ldots F(p_r^{a_r})

And we've already shown that for any prime power pap^a, F(pa)=(a+1)(p1)pa1F(p^a) = (a+1)(p-1)p^{a-1}.

Therefore,

F(n)=i=1rF(piai)=i=1r(ai+1)(pi1)piai1F(n) = \prod_{i=1}^r F(p_i^{a_i}) = \prod_{i=1}^r (a_i+1)(p_i-1)p_i^{a_i-1}

And that, my friends, is the complete proof! We've rigorously shown that the summation i=1,gcd(i,n)=1ngcd(i1,n)\sum_{i=1,\gcd(i,n)=1}^n \gcd(i-1,n) equals i(ai+1)(pi1)piai1\prod_{i} (a_i+1)(p_i-1)p_i^{a_i-1} by first analyzing the case of prime powers and then using the property of multiplicative functions. It's a beautiful result that ties together GCDs, the Totient function implicitly, and the structure of numbers based on their prime factorizations. Pretty neat stuff, right? Keep exploring these number theory puzzles, they're incredibly rewarding!